CAS 1019111-17-1

5-(1-Methylethyl)-1,3,4-oxadiazole-2-propanoic acid

Description:

5-(1-Methylethyl)-1,3,4-oxadiazole-2-propanoic acid, with the CAS number 1019111-17-1, is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a propanoic acid functional group, contributing to its acidic properties. The presence of the isopropyl group (1-methylethyl) enhances its hydrophobic characteristics, potentially influencing its solubility and reactivity in various environments. The oxadiazole moiety is known for its biological activity, often exhibiting antimicrobial and antifungal properties, making this compound of interest in pharmaceutical research. Additionally, the structural configuration may allow for various interactions with biological targets, which could be explored for therapeutic applications. Overall, the unique combination of functional groups and heteroatoms in this compound suggests potential utility in medicinal chemistry and materials science, although specific applications would depend on further research and characterization.

Formula: C₈H₁₂N₂O₃

InChI: InChI=1S/C8H12N2O3/c1-5(2)8-10-9-6(13-8)3-4-7(11)12/h5H,3-4H2,1-2H3,(H,11,12)

InChI key: InChIKey=LQMHXBLLXPHUOL-UHFFFAOYSA-N

SMILES: C(CC(O)=O)C=1OC(C(C)C)=NN1

Synonyms:

• 5-(1-Methylethyl)-1,3,4-oxadiazole-2-propanoic acid
• 1,3,4-Oxadiazole-2-propanoic acid, 5-(1-methylethyl)-
• 3-(5-isopropyl-1,3,4-oxadiazol-2-yl)propanoic acid
• 3-(5-Isopropyl-[1,3,4]oxadiazol-2-yl)-propionic acid
• 3-[5-(propan-2-yl)-1,3,4-oxadiazol-2-yl]propanoic acid

3-(5-Isopropyl-1,3,4-oxadiazol-2-yl)propanoic acid

CAS: 1019111-17-1

Formula: C₈H₁₂N₂O₃

Color and Shape: Solid

Molecular weight: 184.195

Ref: 10-F042437

3-[5-(Propan-2-yl)-1,3,4-oxadiazol-2-yl]propanoic acid

CAS: 1019111-17-1

Versatile small molecule scaffold

Formula: C₈H₁₂N₂O₃

Purity: Min. 95%

Molecular weight: 184.19 g/mol

Ref: 3D-UQB11117