CAS 1019111-20-6

5-Amino-2-(trifluoromethyl)-1H-benzimidazole-1-ethanol

Description:

5-Amino-2-(trifluoromethyl)-1H-benzimidazole-1-ethanol is a chemical compound characterized by its unique structural features, which include a benzimidazole core substituted with an amino group and a trifluoromethyl group, along with an ethanol moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for hydrogen bonding due to the presence of the amino and hydroxyl groups. The trifluoromethyl group contributes to its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The presence of the ethanol group may enhance solubility in polar solvents. This compound may also exhibit interesting reactivity due to the functional groups present, allowing for potential applications in pharmaceuticals or agrochemicals. Its specific interactions and behavior in various environments would depend on factors such as pH, solvent, and temperature, which are critical for understanding its practical applications and efficacy in biological systems.

Formula: C₁₀H₁₀F₃N₃O

InChI: InChI=1S/C10H10F3N3O/c11-10(12,13)9-15-7-5-6(14)1-2-8(7)16(9)3-4-17/h1-2,5,17H,3-4,14H2

InChI key: InChIKey=ILSAMHIFFJYSIP-UHFFFAOYSA-N

SMILES: C(CO)N1C=2C(N=C1C(F)(F)F)=CC(N)=CC2

Synonyms:

• 5-Amino-2-(trifluoromethyl)-1H-benzimidazole-1-ethanol
• 1H-Benzimidazole-1-ethanol, 5-amino-2-(trifluoromethyl)-