
CAS 1019111-21-7
:5-Amino-1-cyclohexyl-1H-benzimidazole-2-methanol
Description:
5-Amino-1-cyclohexyl-1H-benzimidazole-2-methanol is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with an amino group and a cyclohexyl group, as well as a methanol moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the amino group suggests it may engage in hydrogen bonding, enhancing its solubility in polar solvents. The cyclohexyl group can influence the compound's lipophilicity, potentially affecting its pharmacokinetic properties. Additionally, the benzimidazole framework is known for its relevance in medicinal chemistry, often associated with various biological activities, including antimicrobial and anticancer properties. The methanol group may also play a role in the compound's reactivity and interaction with biological targets. Overall, 5-Amino-1-cyclohexyl-1H-benzimidazole-2-methanol presents a combination of structural features that may be of interest in drug development and other chemical applications.
Formula:C14H19N3O
InChI:InChI=1S/C14H19N3O/c15-10-6-7-13-12(8-10)16-14(9-18)17(13)11-4-2-1-3-5-11/h6-8,11,18H,1-5,9,15H2
InChI key:InChIKey=LNXBDHBMFQHJCU-UHFFFAOYSA-N
SMILES:C(O)C=1N(C=2C(N1)=CC(N)=CC2)C3CCCCC3
Synonyms:- 5-Amino-1-cyclohexyl-1H-benzimidazole-2-methanol
- 1H-Benzimidazole-2-methanol, 5-amino-1-cyclohexyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.