CymitQuimica logo

CAS 1019111-22-8

:

5-(Chloromethyl)-2-(1-piperidinyl)[1,2,4]triazolo[1,5-a]pyrimidin-7(1H)-one

Description:
5-(Chloromethyl)-2-(1-piperidinyl)[1,2,4]triazolo[1,5-a]pyrimidin-7(1H)-one is a chemical compound characterized by its complex heterocyclic structure, which includes a triazole and pyrimidine moiety. The presence of a chloromethyl group enhances its reactivity, making it a potential candidate for further chemical modifications. The piperidine ring contributes to its pharmacological properties, often associated with compounds that exhibit biological activity. This substance may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its molecular structure suggests potential interactions with biological targets, which could lead to therapeutic applications. Additionally, the compound's stability and solubility in various solvents can influence its behavior in biological systems and its utility in drug formulation. As with many heterocyclic compounds, understanding its synthesis, reactivity, and biological activity is crucial for exploring its potential applications in drug discovery and development.
Formula:C11H14ClN5O
InChI:InChI=1S/C11H14ClN5O/c12-7-8-6-9(18)17-10(13-8)14-11(15-17)16-4-2-1-3-5-16/h6H,1-5,7H2,(H,13,14,15)
InChI key:InChIKey=KUCSVWHMEPBAII-UHFFFAOYSA-N
SMILES:O=C1N2C(NC(=N2)N3CCCCC3)=NC(CCl)=C1
Synonyms:
  • 5-(Chloromethyl)-2-(1-piperidinyl)[1,2,4]triazolo[1,5-a]pyrimidin-7(1H)-one
  • [1,2,4]Triazolo[1,5-a]pyrimidin-7(1H)-one, 5-(chloromethyl)-2-(1-piperidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.