CAS 1019111-59-1

4-[[[(3,5-Dimethoxyphenyl)methyl]thio]methyl]-2-thiazolamine

Description:

4-[[[(3,5-Dimethoxyphenyl)methyl]thio]methyl]-2-thiazolamine is a chemical compound characterized by its unique structural features, which include a thiazole ring and a thioether linkage. The presence of the 3,5-dimethoxyphenyl group contributes to its potential for various biological activities, as methoxy groups can enhance lipophilicity and influence the compound's interaction with biological targets. The thiazole moiety is known for its role in medicinal chemistry, often exhibiting antimicrobial and antifungal properties. This compound may also possess potential as a pharmacophore due to its ability to interact with specific receptors or enzymes. Its synthesis typically involves multi-step organic reactions, and it may be evaluated for its efficacy in various biological assays. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the aromatic ring and the thiazole structure, making it a subject of interest in drug development and chemical research. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₃H₁₆N₂O₂S₂

InChI: InChI=1S/C13H16N2O2S2/c1-16-11-3-9(4-12(5-11)17-2)6-18-7-10-8-19-13(14)15-10/h3-5,8H,6-7H2,1-2H3,(H2,14,15)

InChI key: InChIKey=QSAZXSKGBDFZAP-UHFFFAOYSA-N

SMILES: C(SCC=1N=C(N)SC1)C2=CC(OC)=CC(OC)=C2

Synonyms:

• 4-[[[(3,5-Dimethoxyphenyl)methyl]thio]methyl]-2-thiazolamine
• 2-Thiazolamine, 4-[[[(3,5-dimethoxyphenyl)methyl]thio]methyl]-

4-{[(3,5-dimethoxybenzyl)thio]methyl}-1,3-thiazol-2-amine

CAS: 1019111-59-1

Formula: C₁₃H₁₆N₂O₂S₂

Purity: 95.0%

Molecular weight: 296.4

Ref: 10-F512008