CAS 1019111-85-3

7-Bromo-5-chloro-3-methyl-2-benzofurancarboxylic acid

Description:

7-Bromo-5-chloro-3-methyl-2-benzofurancarboxylic acid is a chemical compound characterized by its unique structure, which includes a benzofuran moiety substituted with bromine and chlorine atoms, as well as a carboxylic acid functional group. This compound typically exhibits properties associated with halogenated aromatic compounds, such as increased reactivity and potential for various chemical transformations. The presence of the carboxylic acid group suggests it can participate in acid-base reactions and may serve as a precursor for further synthetic modifications. Additionally, the bromine and chlorine substituents can influence the compound's solubility, stability, and biological activity, making it of interest in medicinal chemistry and material science. Its specific applications may vary, but compounds with similar structures are often explored for their potential in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. As with many halogenated compounds, safety considerations regarding toxicity and environmental impact are essential when handling or utilizing this substance.

Formula: C₁₀H₆BrClO₃

InChI: InChI=1S/C10H6BrClO3/c1-4-6-2-5(12)3-7(11)9(6)15-8(4)10(13)14/h2-3H,1H3,(H,13,14)

InChI key: InChIKey=ORWIALWRQZLXAE-UHFFFAOYSA-N

SMILES: BrC1=C2C(C(C)=C(C(O)=O)O2)=CC(Cl)=C1

Synonyms:

• 2-Benzofurancarboxylic acid, 7-bromo-5-chloro-3-methyl-
• 7-Bromo-5-chloro-3-methyl-2-benzofurancarboxylic acid

7-Bromo-5-chloro-3-methyl-1-benzofuran-2-carboxylic acid

CAS: 1019111-85-3

Versatile small molecule scaffold

Formula: C₁₀H₆BrClO₃

Purity: Min. 95%

Molecular weight: 289.51 g/mol

Ref: 3D-UQB11185