CAS 1019115-35-5

2-[[(2-Methylpropoxy)carbonyl]amino]-4-thiazoleacetic acid

Description:

2-[[(2-Methylpropoxy)carbonyl]amino]-4-thiazoleacetic acid is a chemical compound characterized by its unique structural features, which include a thiazole ring and an acetic acid moiety. The presence of the thiazole ring contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The compound contains a carboxylic acid functional group, which imparts acidic properties and can influence solubility and reactivity. Additionally, the 2-methylpropoxycarbonyl group enhances its lipophilicity, potentially affecting its absorption and distribution in biological systems. This compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas related to anti-inflammatory or antimicrobial agents. However, detailed studies on its pharmacokinetics, toxicity, and efficacy would be necessary to fully understand its potential uses and safety profile. Overall, 2-[[(2-Methylpropoxy)carbonyl]amino]-4-thiazoleacetic acid represents a complex molecule with promising characteristics for further research.

Formula: C₁₀H₁₄N₂O₄S

InChI: InChI=1S/C10H14N2O4S/c1-6(2)4-16-10(15)12-9-11-7(5-17-9)3-8(13)14/h5-6H,3-4H2,1-2H3,(H,13,14)(H,11,12,15)

InChI key: InChIKey=GLKJXYIOPFZUMH-UHFFFAOYSA-N

SMILES: N(C(OCC(C)C)=O)C1=NC(CC(O)=O)=CS1

Synonyms:

• 4-Thiazoleacetic acid, 2-[[(2-methylpropoxy)carbonyl]amino]-
• 2-[[(2-Methylpropoxy)carbonyl]amino]-4-thiazoleacetic acid