CAS 1019115-39-9

2-[[(1,2-Dihydro-2-oxo-3-pyridinyl)carbonyl]amino]-4-thiazoleacetic acid

Description:

2-[[(1,2-Dihydro-2-oxo-3-pyridinyl)carbonyl]amino]-4-thiazoleacetic acid, with CAS number 1019115-39-9, is a chemical compound characterized by its complex structure that includes a thiazole ring and a pyridine moiety. This compound features a carboxylic acid functional group, which contributes to its acidic properties, and an amide linkage that connects the thiazole and pyridine components. The presence of the thiazole ring imparts unique reactivity and potential biological activity, making it of interest in medicinal chemistry. The compound may exhibit properties such as antimicrobial or anti-inflammatory effects, although specific biological activities would depend on further empirical studies. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, this compound represents a class of heterocyclic compounds that are often explored for their pharmacological potential and applications in drug development.

Formula: C₁₁H₉N₃O₄S

InChI: InChI=1S/C11H9N3O4S/c15-8(16)4-6-5-19-11(13-6)14-10(18)7-2-1-3-12-9(7)17/h1-3,5H,4H2,(H,12,17)(H,15,16)(H,13,14,18)

InChI key: InChIKey=CATUSLDIVXPFEL-UHFFFAOYSA-N

SMILES: C(NC1=NC(CC(O)=O)=CS1)(=O)C=2C(=O)NC=CC2

Synonyms:

• 4-Thiazoleacetic acid, 2-[[(1,2-dihydro-2-oxo-3-pyridinyl)carbonyl]amino]-
• 2-[[(1,2-Dihydro-2-oxo-3-pyridinyl)carbonyl]amino]-4-thiazoleacetic acid