CAS 1019115-45-7

N-(2-Bromo-6-benzothiazolyl)acetamide

Description:

N-(2-Bromo-6-benzothiazolyl)acetamide is a chemical compound characterized by its unique structure, which includes a benzothiazole moiety and a bromine substituent. The presence of the bromine atom enhances its reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many benzothiazole derivatives. It may display various biological activities, making it of interest in pharmaceutical research, particularly in the development of antimicrobial or anticancer agents. The acetamide functional group contributes to its ability to participate in hydrogen bonding, influencing its interactions with biological targets. Additionally, the compound's stability and reactivity can be affected by environmental conditions such as pH and temperature. As with many halogenated compounds, safety precautions should be taken during handling due to potential toxicity. Overall, N-(2-Bromo-6-benzothiazolyl)acetamide represents a valuable compound for further investigation in medicinal chemistry and related fields.

Formula: C₉H₇BrN₂OS

InChI: InChI=1S/C9H7BrN2OS/c1-5(13)11-6-2-3-7-8(4-6)14-9(10)12-7/h2-4H,1H3,(H,11,13)

InChI key: InChIKey=YCTZWIATSOVTTE-UHFFFAOYSA-N

SMILES: N(C(C)=O)C=1C=C2C(=CC1)N=C(Br)S2

Synonyms:

• Acetamide, N-(2-bromo-6-benzothiazolyl)-
• N-(2-Bromo-6-benzothiazolyl)acetamide