CAS 1019117-30-6
:4-[[[(4-Fluorophenyl)methyl]thio]methyl]-2-thiazolamine
Description:
4-[[[(4-Fluorophenyl)methyl]thio]methyl]-2-thiazolamine is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. The presence of a fluorophenyl group indicates that a fluorine atom is substituted on a phenyl ring, which can influence the compound's electronic properties and reactivity. The thioether linkage (methylthio) suggests that the compound may exhibit unique chemical behavior, including potential nucleophilic properties. This compound may be of interest in medicinal chemistry due to its structural features, which could contribute to biological activity. Its specific interactions, solubility, and stability would depend on the functional groups present and their spatial arrangement. Additionally, the compound's CAS number, 1019117-30-6, allows for precise identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and agrochemicals. Overall, the characteristics of this compound suggest potential utility in drug development or as a research tool in chemical biology.
Formula:C11H11FN2S2
InChI:InChI=1S/C11H11FN2S2/c12-9-3-1-8(2-4-9)5-15-6-10-7-16-11(13)14-10/h1-4,7H,5-6H2,(H2,13,14)
InChI key:InChIKey=XXLUMPMEWNMSBI-UHFFFAOYSA-N
SMILES:C(SCC1=CC=C(F)C=C1)C=2N=C(N)SC2
Synonyms:- 4-[[[(4-Fluorophenyl)methyl]thio]methyl]-2-thiazolamine
- 2-Thiazolamine, 4-[[[(4-fluorophenyl)methyl]thio]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.