CymitQuimica logo

CAS 1019117-37-3

:

2-Bromo-6-fluoro-4-methylbenzothiazole

Description:
2-Bromo-6-fluoro-4-methylbenzothiazole is a heterocyclic organic compound characterized by the presence of both bromine and fluorine substituents on a benzothiazole ring. This compound features a benzothiazole backbone, which consists of a benzene ring fused to a thiazole ring, contributing to its aromatic properties and potential biological activity. The bromine and fluorine atoms introduce significant electronegativity and steric effects, which can influence the compound's reactivity and interactions with biological targets. Typically, compounds like this may exhibit antimicrobial, antifungal, or anticancer properties, making them of interest in pharmaceutical research. The presence of the methyl group further modifies the electronic and steric environment of the molecule. Additionally, the compound's solubility, stability, and reactivity can be affected by the substituents, making it a candidate for various applications in medicinal chemistry and material science. Safety and handling precautions are essential due to the presence of halogens, which can pose health risks.
Formula:C8H5BrFNS
InChI:InChI=1S/C8H5BrFNS/c1-4-2-5(10)3-6-7(4)11-8(9)12-6/h2-3H,1H3
InChI key:InChIKey=CKDWCQLRGQBNNR-UHFFFAOYSA-N
SMILES:CC1=C2C(SC(Br)=N2)=CC(F)=C1
Synonyms:
  • Benzothiazole, 2-bromo-6-fluoro-4-methyl-
  • 2-Bromo-6-fluoro-4-methylbenzothiazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.