CymitQuimica logo

CAS 1019128-90-5

:

(3-(cyclohexylmethoxy)phenyl)methanamine

Description:
The chemical substance known as (3-(cyclohexylmethoxy)phenyl)methanamine, with the CAS number 1019128-90-5, is an organic compound characterized by its phenyl and amine functional groups. It features a cyclohexylmethoxy substituent, which contributes to its hydrophobic properties and influences its interaction with biological systems. The presence of the methanamine group suggests potential basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for research in medicinal chemistry. Its molecular structure indicates potential for forming hydrogen bonds, which can affect solubility and reactivity. Additionally, the cyclohexyl group may provide steric hindrance, influencing the compound's conformation and interactions with other molecules. Overall, (3-(cyclohexylmethoxy)phenyl)methanamine is a compound of interest in both synthetic and medicinal chemistry, warranting further investigation into its properties and potential applications.
Formula:C14H21NO
InChI:InChI=1S/C14H21NO/c15-10-13-7-4-8-14(9-13)16-11-12-5-2-1-3-6-12/h4,7-9,12H,1-3,5-6,10-11,15H2
InChI key:HODMFYQUMLYILA-UHFFFAOYSA-N
SMILES:C1CCC(CC1)COc1cccc(c1)CN
Synonyms:
  • 1-[3-(Cyclohexylmethoxy)phenyl]methanamine
Found 2 products.