CymitQuimica logo

CAS 101913-80-8

:

2,6-bis(chlorodifluoromethyl)-1,7-dichloro-2,6-dihydroxy-1,1,7,7-tetrafluo ro-4-heptanon oxime

Description:
2,6-bis(chlorodifluoromethyl)-1,7-dichloro-2,6-dihydroxy-1,1,7,7-tetrafluoro-4-heptanone oxime, identified by CAS number 101913-80-8, is a complex organic compound characterized by its multiple halogen substituents and functional groups. This substance features a heptanone backbone, which is modified by the presence of two chlorodifluoromethyl groups and several chlorine and fluorine atoms, contributing to its unique chemical properties. The presence of hydroxyl groups indicates potential for hydrogen bonding, which can influence its solubility and reactivity. The compound is likely to exhibit significant stability due to the presence of fluorine atoms, which are known for their electronegativity and ability to enhance the thermal and chemical stability of organic molecules. Additionally, the chlorinated and fluorinated nature of this compound suggests potential applications in fields such as agrochemicals or materials science, although specific applications would depend on further research into its biological activity and environmental impact. Overall, this compound exemplifies the complexity and diversity of halogenated organic substances.
Formula:C9H7Cl4F8NO3
InChI:InChI=1/C9H7Cl4F8NO3/c10-6(14,15)4(23,7(11,16)17)1-3(22-25)2-5(24,8(12,18)19)9(13,20)21/h23-25H,1-2H2
SMILES:C(C(=NO)CC(C(Cl)(F)F)(C(Cl)(F)F)O)C(C(Cl)(F)F)(C(Cl)(F)F)O
Synonyms:
  • 4-Heptanone, 2,6-bis(chlorodifluoromethyl)-1,7-dichloro-2,6-dihydroxy-1,1,7,7-tetrafluoro-, oxime
  • 1,7-Dichloro-2,6-Bis[Chloro(Difluoro)Methyl]-1,1,7,7-Tetrafluoro-4-(Hydroxyimino)Heptane-2,6-Diol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.