CymitQuimica logo

CAS 101913-93-3

:

1-chloro-6-(chloro-difluoro-methyl)-1,1,7,7,7-pentafluoro-4-hydrazinyl idene-2-(trifluoromethyl)heptane-2,6-diol

Description:
1-Chloro-6-(chloro-difluoro-methyl)-1,1,7,7,7-pentafluoro-4-hydrazinyl idene-2-(trifluoromethyl)heptane-2,6-diol, with CAS number 101913-93-3, is a complex organic compound characterized by its multiple halogen substituents and hydrazine functional group. The presence of multiple fluorine atoms contributes to its high lipophilicity and potential volatility, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The compound's structure indicates significant steric hindrance due to the bulky fluorinated groups, which may influence its reactivity and interaction with biological systems. Additionally, the hydrazine moiety suggests potential for redox activity, which could be relevant in synthetic chemistry or as a precursor in the formation of other chemical entities. Its unique combination of functional groups and substituents may also impart specific properties such as stability under certain conditions, making it a candidate for further study in material science or medicinal chemistry. However, detailed safety and handling information should be consulted due to the presence of halogens and hydrazine, which can pose health risks.
Formula:C9H8Cl2F10N2O2
InChI:InChI=1/C9H8Cl2F10N2O2/c10-6(12,13)4(24,8(16,17)18)1-3(23-22)2-5(25,7(11,14)15)9(19,20)21/h24-25H,1-2,22H2
SMILES:C(C(=NN)CC(C(Cl)(F)F)(C(F)(F)F)O)C(C(Cl)(F)F)(C(F)(F)F)O
Synonyms:
  • 4-Heptanone, 1,7-dichloro-2,6-dihydroxy-2,6-bis(trifluoromethyl)-1,1,7,7-tetrafluoro-, hydrazone
  • 1,7-Dichloro-1,1,7,7-Tetrafluoro-4-Hydrazinylidene-2,6-Bis(Trifluoromethyl)Heptane-2,6-Diol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.