CAS 10192-93-5
:3,4-Dimethyl-3,4-diphenylhexane
Description:
3,4-Dimethyl-3,4-diphenylhexane is an organic compound characterized by its complex hydrocarbon structure, featuring two methyl groups and two phenyl groups attached to a hexane backbone. This compound belongs to the class of alkanes and is classified as a substituted hydrocarbon due to the presence of the methyl and phenyl substituents. It is typically a colorless to pale yellow liquid at room temperature, exhibiting low solubility in water but higher solubility in organic solvents. The presence of multiple aromatic rings contributes to its stability and potential for various chemical reactions, including electrophilic aromatic substitution. Its molecular structure allows for various isomeric forms, which can influence its physical and chemical properties, such as boiling point and melting point. 3,4-Dimethyl-3,4-diphenylhexane may be of interest in organic synthesis and materials science, particularly in the development of polymers or as a precursor in the synthesis of more complex organic molecules. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C20H26
InChI:InChI=1S/C20H26/c1-5-19(3,17-13-9-7-10-14-17)20(4,6-2)18-15-11-8-12-16-18/h7-16H,5-6H2,1-4H3
InChI key:InChIKey=WQJUBZMZVKITBU-UHFFFAOYSA-N
SMILES:C(C(CC)(C)C1=CC=CC=C1)(CC)(C)C2=CC=CC=C2
Synonyms:- (3,4-Dimethyl-4-phenylhexan-3-yl)benzene
- (3,4-Dimethylhexane-3,4-diyl)dibenzene
- 1,1'-(1,2-Diethyl-1,2-dimethylethylene)bisbenzene
- 1,1'-(3,4-Dimethylhexane-3,4-Diyl)Dibenzene
- 1,1′-(1,2-Diethyl-1,2-dimethyl-1,2-ethanediyl)bis[benzene]
- 1,1′-(1,2-Diethyl-1,2-dimethylethylene)bis[benzene]
- 1,2-Dimethyl-1,2-diethyl-1,2-diphenylethane
- 2,3-Diethyl-2,3-diphenylbutane
- 3,4-Diphenyl-3,4-dimethylhexane
- Benzene, 1,1'-(1,2-diethyl-1,2-dimethyl-1,2-ethanediyl)bis-
- Bibenzyl, α,α′-diethyl-α,α′-dimethyl-
- Interox CC-DFH
- Perkadox 58
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.