CymitQuimica logo

CAS 101925-24-0

:

4-(1-Methylethyl)-3-pyridinol

Description:
4-(1-Methylethyl)-3-pyridinol, also known by its CAS number 101925-24-0, is an organic compound characterized by a pyridine ring substituted with a hydroxyl group and an isopropyl group. This compound features a pyridine structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of the hydroxyl (-OH) group indicates that it is a pyridinol, which can exhibit properties typical of alcohols, such as hydrogen bonding capabilities. The isopropyl group contributes to its hydrophobic characteristics, influencing its solubility and reactivity. This compound may be of interest in various chemical applications, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its molecular structure suggests that it could participate in various chemical reactions, such as nucleophilic substitutions or coordination with metal ions. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on its concentration and exposure levels.
Formula:C8H11NO
InChI:InChI=1S/C8H11NO/c1-6(2)7-3-4-9-5-8(7)10/h3-6,10H,1-2H3
InChI key:InChIKey=RHZFCLBCFSZTKM-UHFFFAOYSA-N
SMILES:C(C)(C)C=1C(O)=CN=CC1
Synonyms:
  • 3-Pyridinol, 4-(1-methylethyl)-
  • 4-(1-Methylethyl)-3-pyridinol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.