CAS 101927-33-7
:2-Iodopropane-d7
Description:
2-Iodopropane-d7, also known as deuterated 2-iodopropane, is a chemical compound characterized by the presence of deuterium, a stable isotope of hydrogen, replacing the hydrogen atoms in the propane structure. This compound has the molecular formula C3H7I, with the deuterated version specifically incorporating seven deuterium atoms, resulting in a heavier isotopic variant. It is a colorless liquid at room temperature and is known for its use in various applications, including as a solvent and in organic synthesis, particularly in studies involving NMR spectroscopy due to its unique isotopic labeling. The presence of iodine in its structure contributes to its reactivity, making it useful in nucleophilic substitution reactions. Additionally, the deuteration enhances its stability and alters its physical properties, such as boiling and melting points, compared to its non-deuterated counterpart. As with many halogenated compounds, safety precautions should be taken when handling 2-iodopropane-d7, as it may pose health risks and environmental concerns.
Formula:C3D7I
InChI:InChI=1/C3H7I/c1-3(2)4/h3H,1-2H3/i1D3,2D3,3D
SMILES:C(C(C([2H])([2H])[2H])(I)[2H])([2H])([2H])[2H]
Synonyms:- 2-iodo(2H7)propane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Iodopropane-d7
CAS:Formula:(CD3)2CDIPurity:98 atom % DColor and Shape:Colourless-Pale Yellow LiquidMolecular weight:177.003182-Iodopropane-d7
CAS:Controlled Product<p>Applications 2-Iodopropane-d7 is the isotope labelled analog of 2-Iodopropane (I718795); a reagent used in the synthesis of 4'-O-alkyl-chitobiosyl-4-methylumbelliferone as human chitinase fluorogenic substrates.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Duivenvoorden, B.A., et al.: Carbohyd. Res., no vol., no pp. (2014, ahead of print)<br></p>Formula:C3D7IColor and Shape:NeatMolecular weight:177



