CAS 101927-55-3

4-(1,1-Dimethylethyl)-N-(phenylmethyl)benzamide

Description:

4-(1,1-Dimethylethyl)-N-(phenylmethyl)benzamide, identified by its CAS number 101927-55-3, is an organic compound characterized by its amide functional group, which is formed from the reaction of a carboxylic acid and an amine. This compound features a bulky tert-butyl group (1,1-dimethylethyl) attached to a benzene ring, which contributes to its steric hindrance and potentially influences its reactivity and solubility. The presence of the phenylmethyl group (benzyl) on the nitrogen atom adds to its structural complexity and may affect its interactions with biological targets or other chemical species. Typically, compounds of this nature may exhibit properties such as moderate to high lipophilicity due to their aromatic and aliphatic components, which can influence their behavior in biological systems and their potential applications in pharmaceuticals or agrochemicals. Additionally, the specific arrangement of substituents can lead to unique physical and chemical properties, making it of interest in various fields of research.

Formula: C₁₈H₂₁NO

InChI: InChI=1S/C18H21NO/c1-18(2,3)16-11-9-15(10-12-16)17(20)19-13-14-7-5-4-6-8-14/h4-12H,13H2,1-3H3,(H,19,20)

InChI key: InChIKey=YDWFQKUSPZKUPI-UHFFFAOYSA-N

SMILES: C(NCC1=CC=CC=C1)(=O)C2=CC=C(C(C)(C)C)C=C2

Synonyms:

• 4-(1,1-Dimethylethyl)-N-(phenylmethyl)benzamide
• N-Benzyl-4-tert-butylbenzamide
• Benzamide, 4-(1,1-dimethylethyl)-N-(phenylmethyl)-