
CAS 10193-26-7
:3a,4,7,7a-Tetrahydro-8-(2-propen-1-yl)-4,7-methanoisobenzofuran-1,3-dione
Description:
3a,4,7,7a-Tetrahydro-8-(2-propen-1-yl)-4,7-methanoisobenzofuran-1,3-dione, identified by its CAS number 10193-26-7, is a synthetic organic compound characterized by its complex bicyclic structure. This compound features a fused bicyclic system that includes a methanoisobenzofuran moiety, which contributes to its unique chemical properties. The presence of a propenyl group indicates potential reactivity, particularly in addition reactions, making it of interest in organic synthesis. The compound is likely to exhibit moderate to low solubility in water, typical of many organic compounds with large hydrophobic regions. Its molecular structure suggests potential applications in medicinal chemistry, possibly as a precursor or intermediate in the synthesis of biologically active molecules. Additionally, the presence of dione functional groups may confer reactivity towards nucleophiles, allowing for further derivatization. Overall, this compound's structural features and functional groups make it a subject of interest for further research in organic and medicinal chemistry.
Formula:C12H12O3
InChI:InChI=1S/C12H12O3/c1-2-3-6-7-4-5-8(6)10-9(7)11(13)15-12(10)14/h2,4-10H,1,3H2
InChI key:InChIKey=UAOSUOQUDOREIP-UHFFFAOYSA-N
SMILES:O=C1C2C(C3C(CC=C)C2C=C3)C(=O)O1
Synonyms:- 4,7-Methanoisobenzofuran-1,3-dione, 3a,4,7,7a-tetrahydro-8-(2-propen-1-yl)-
- 3a,4,7,7a-Tetrahydro-8-(2-propen-1-yl)-4,7-methanoisobenzofuran-1,3-dione
- 5-Norbornene-2,3-dicarboxylic anhydride, 7-allyl-
- 4,7-Methanoisobenzofuran-1,3-dione, 3a,4,7,7a-tetrahydro-8-(2-propenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4,7-Methanoisobenzofuran-1,3-dione, 3a,4,7,7a-tetrahydro-8-(2-propen-1-yl)-
CAS:Formula:C12H12O3Molecular weight:204.2219

