CAS 101931-72-0
:(4Z)-4-[(2,4-dinitrophenyl)hydrazono]-1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-ol
Description:
The chemical substance known as (4Z)-4-[(2,4-dinitrophenyl)hydrazono]-1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-ol, with the CAS number 101931-72-0, exhibits several notable characteristics. It is a complex organic compound featuring a hydrazone functional group, which is indicative of its potential reactivity and ability to form derivatives. The presence of trifluoromethyl and trifluoro groups suggests significant lipophilicity and potential applications in pharmaceuticals or agrochemicals due to their influence on biological activity and molecular interactions. The dinitrophenyl moiety contributes to its electronic properties, potentially enhancing its reactivity in various chemical reactions. Additionally, the compound's structure implies it may exhibit unique physical properties, such as solubility in organic solvents and stability under certain conditions. Overall, this compound's unique combination of functional groups and substituents makes it a subject of interest in synthetic chemistry and materials science, warranting further investigation into its applications and behavior in different chemical environments.
Formula:C12H10F6N4O5
InChI:InChI=1/C12H10F6N4O5/c1-6(5-10(23,11(13,14)15)12(16,17)18)19-20-8-3-2-7(21(24)25)4-9(8)22(26)27/h2-4,20,23H,5H2,1H3/b19-6-
SMILES:C/C(=N/Nc1ccc(cc1N(=O)=O)N(=O)=O)/CC(C(F)(F)F)(C(F)(F)F)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.