
CAS 1019359-61-5
:N-(5-Amino-2-methoxyphenyl)-2-(4-methylphenoxy)propanamide
Description:
N-(5-Amino-2-methoxyphenyl)-2-(4-methylphenoxy)propanamide, with the CAS number 1019359-61-5, is a chemical compound characterized by its amide functional group, which is indicative of its potential biological activity. The structure features an aromatic ring with a methoxy group and an amino group, contributing to its polarity and solubility properties. The presence of the 4-methylphenoxy group enhances its hydrophobic characteristics, which may influence its interaction with biological membranes. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's stability, reactivity, and interaction with other molecules can be influenced by the functional groups present, which may affect its efficacy and safety profile in biological systems. Overall, N-(5-Amino-2-methoxyphenyl)-2-(4-methylphenoxy)propanamide represents a complex organic molecule with potential utility in pharmaceutical research.
Formula:C17H20N2O3
InChI:InChI=1S/C17H20N2O3/c1-11-4-7-14(8-5-11)22-12(2)17(20)19-15-10-13(18)6-9-16(15)21-3/h4-10,12H,18H2,1-3H3,(H,19,20)
InChI key:InChIKey=MMKMDKBPEJAMDB-UHFFFAOYSA-N
SMILES:N(C(C(OC1=CC=C(C)C=C1)C)=O)C2=C(OC)C=CC(N)=C2
Synonyms:- N-(5-Amino-2-methoxyphenyl)-2-(4-methylphenoxy)propanamide
- Propanamide, N-(5-amino-2-methoxyphenyl)-2-(4-methylphenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.