CAS 1019372-32-7

2-(3-Chlorophenoxy)-3-methylbutanoic acid

Description:

2-(3-Chlorophenoxy)-3-methylbutanoic acid, identified by its CAS number 1019372-32-7, is a chemical compound that belongs to the class of herbicides. It features a chlorophenoxy group, which is known for its effectiveness in disrupting plant growth by mimicking natural plant hormones. The structure includes a butanoic acid backbone with a methyl group and a chlorine-substituted phenyl ring, contributing to its herbicidal properties. This compound is typically characterized by its moderate solubility in organic solvents and limited solubility in water, which influences its application and environmental behavior. Its mode of action primarily involves the inhibition of specific enzymatic pathways in plants, leading to growth regulation and eventual plant death. Safety and environmental impact assessments are crucial for its use, as with many herbicides, to mitigate potential risks to non-target organisms and ecosystems. Overall, 2-(3-Chlorophenoxy)-3-methylbutanoic acid exemplifies the complex interplay between chemical structure and biological activity in agrochemicals.

Formula: C₁₁H₁₃ClO₃

InChI: InChI=1S/C11H13ClO3/c1-7(2)10(11(13)14)15-9-5-3-4-8(12)6-9/h3-7,10H,1-2H3,(H,13,14)

InChI key: InChIKey=ZXBVQYOLEDJCOA-UHFFFAOYSA-N

SMILES: O(C(C(C)C)C(O)=O)C1=CC(Cl)=CC=C1

Synonyms:

• Butanoic acid, 2-(3-chlorophenoxy)-3-methyl-
• 2-(3-Chlorophenoxy)-3-methylbutanoic acid

2-(3-Chlorophenoxy)-3-methylbutanoic acid

CAS: 1019372-32-7

Versatile small molecule scaffold

Formula: C₁₁H₁₃ClO₃

Purity: Min. 95%

Molecular weight: 228.67 g/mol

Ref: 3D-UQB37232