CAS 1019388-11-4
:2-[(1-Methylpropyl)amino]-4-pyridinecarboxylic acid
Description:
2-[(1-Methylpropyl)amino]-4-pyridinecarboxylic acid, identified by its CAS number 1019388-11-4, is a chemical compound characterized by its pyridine ring structure substituted with both an amino group and a carboxylic acid group. This compound features a branched alkyl chain, specifically a 1-methylpropyl group, attached to the amino nitrogen, which influences its solubility and reactivity. The presence of the carboxylic acid group contributes to its acidic properties, making it capable of participating in various chemical reactions, including esterification and amide formation. The pyridine moiety provides basic characteristics, allowing for potential interactions with other chemical species. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C10H14N2O2
InChI:InChI=1S/C10H14N2O2/c1-3-7(2)12-9-6-8(10(13)14)4-5-11-9/h4-7H,3H2,1-2H3,(H,11,12)(H,13,14)
InChI key:InChIKey=UJINVBFLHIOPES-UHFFFAOYSA-N
SMILES:N(C(CC)C)C1=CC(C(O)=O)=CC=N1
Synonyms:- 4-Pyridinecarboxylic acid, 2-[(1-methylpropyl)amino]-
- 2-[(1-Methylpropyl)amino]-4-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
