CAS 1019461-36-9

2-(Phenylamino)-4-pyridinecarboxylic acid

Description:

2-(Phenylamino)-4-pyridinecarboxylic acid, also known by its CAS number 1019461-36-9, is an organic compound characterized by the presence of both a pyridine and an aniline moiety. This compound features a pyridine ring substituted with a carboxylic acid group and a phenylamino group, which contributes to its potential as a bioactive molecule. The presence of the carboxylic acid functional group imparts acidic properties, while the aromatic phenyl group enhances its lipophilicity and may influence its interaction with biological targets. This compound may exhibit various chemical behaviors, including hydrogen bonding and potential coordination with metal ions, making it of interest in medicinal chemistry and materials science. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. Additionally, the compound's solubility and stability can be influenced by pH and solvent conditions, which are important considerations for its practical applications.

Formula: C₁₂H₁₀N₂O₂

InChI: InChI=1S/C12H10N2O2/c15-12(16)9-6-7-13-11(8-9)14-10-4-2-1-3-5-10/h1-8H,(H,13,14)(H,15,16)

InChI key: InChIKey=HZRCPZQBVMUEOS-UHFFFAOYSA-N

SMILES: N(C1=CC(C(O)=O)=CC=N1)C2=CC=CC=C2

Synonyms:

• 2-(Phenylamino)-4-pyridinecarboxylic acid
• 4-Pyridinecarboxylic acid, 2-(phenylamino)-
• 2-Anilinoisonicotinic acid