CymitQuimica logo

CAS 1019461-43-8

:

2-(2-Methyl-1-piperidinyl)-3-pyridinecarboxylic acid

Description:
2-(2-Methyl-1-piperidinyl)-3-pyridinecarboxylic acid, identified by its CAS number 1019461-43-8, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a piperidine moiety. This compound typically exhibits properties associated with both heterocyclic amines and carboxylic acids, suggesting potential polar characteristics due to the presence of the carboxylic acid functional group. It may exhibit moderate solubility in polar solvents, while its lipophilicity could be influenced by the piperidine and methyl substituents. The compound's structure may confer biological activity, making it of interest in medicinal chemistry and pharmacology. Its potential applications could include roles as intermediates in organic synthesis or as active pharmaceutical ingredients. As with many heterocyclic compounds, it may also display specific reactivity patterns, such as undergoing nucleophilic substitutions or participating in coupling reactions. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C12H16N2O2
InChI:InChI=1S/C12H16N2O2/c1-9-5-2-3-8-14(9)11-10(12(15)16)6-4-7-13-11/h4,6-7,9H,2-3,5,8H2,1H3,(H,15,16)
InChI key:InChIKey=DVTJGKUPQDZSGT-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N=CC=C1)N2C(C)CCCC2
Synonyms:
  • 2-(2-Methyl-1-piperidinyl)-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 2-(2-methyl-1-piperidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.