CymitQuimica logo

CAS 1019480-20-6

:

N-(2-Methoxy-1-methylethyl)-5-methyl-2-furanmethanamine

Description:
N-(2-Methoxy-1-methylethyl)-5-methyl-2-furanmethanamine, identified by its CAS number 1019480-20-6, is a chemical compound characterized by its unique molecular structure, which includes a furan ring and an amine functional group. This compound features a methoxy group and a branched alkyl chain, contributing to its potential solubility in organic solvents. The presence of the furan ring suggests that it may exhibit aromatic properties, which can influence its reactivity and interactions with other substances. Additionally, the amine group indicates that it may participate in hydrogen bonding, affecting its physical properties such as boiling point and solubility in water. The compound's specific applications and biological activity would depend on its structural characteristics, making it of interest in fields such as medicinal chemistry and materials science. However, detailed information regarding its toxicity, stability, and environmental impact would require further investigation and analysis.
Formula:C10H17NO2
InChI:InChI=1S/C10H17NO2/c1-8(7-12-3)11-6-10-5-4-9(2)13-10/h4-5,8,11H,6-7H2,1-3H3
InChI key:InChIKey=WTWAOCJVCFAMIP-UHFFFAOYSA-N
SMILES:C(NC(COC)C)C=1OC(C)=CC1
Synonyms:
  • 2-Furanmethanamine, N-(2-methoxy-1-methylethyl)-5-methyl-
  • N-(2-Methoxy-1-methylethyl)-5-methyl-2-furanmethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.