
CAS 1019484-55-9
:N-[3-(Methylthio)phenyl]-3-thiophenemethanamine
Description:
N-[3-(Methylthio)phenyl]-3-thiophenemethanamine, identified by its CAS number 1019484-55-9, is a chemical compound that features a complex structure comprising a thiophenemethanamine core and a methylthio-substituted phenyl group. This compound is characterized by the presence of sulfur atoms in both the methylthio group and the thiophene ring, which can impart unique electronic and steric properties. The presence of the amine functional group suggests potential for hydrogen bonding and reactivity, making it of interest in various chemical applications, including medicinal chemistry and materials science. The compound's solubility, stability, and reactivity can be influenced by the arrangement of its functional groups, and it may exhibit specific biological activities due to its structural features. As with many organic compounds, its properties can vary based on environmental conditions such as temperature and pH. Safety data and handling precautions should be consulted when working with this substance, as with any chemical compound.
Formula:C12H13NS2
InChI:InChI=1S/C12H13NS2/c1-14-12-4-2-3-11(7-12)13-8-10-5-6-15-9-10/h2-7,9,13H,8H2,1H3
InChI key:InChIKey=JGSIGXSTMOMINF-UHFFFAOYSA-N
SMILES:N(CC=1C=CSC1)C2=CC(SC)=CC=C2
Synonyms:- N-[3-(Methylthio)phenyl]-3-thiophenemethanamine
- 3-Thiophenemethanamine, N-[3-(methylthio)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.