CAS 1019489-98-5

N-(2,4-Dimethylphenyl)-3-thiophenemethanamine

Description:

N-(2,4-Dimethylphenyl)-3-thiophenemethanamine, identified by its CAS number 1019489-98-5, is an organic compound characterized by its unique structure that includes a thiophene ring and a substituted aniline moiety. The presence of the 2,4-dimethylphenyl group contributes to its hydrophobic characteristics, while the thiophene ring introduces aromaticity and potential reactivity due to its sulfur atom. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and interaction with other molecules. Additionally, the specific arrangement of methyl groups on the phenyl ring can affect steric hindrance and electronic distribution, potentially impacting its biological activity and reactivity in chemical reactions. Such compounds are often of interest in medicinal chemistry and materials science due to their potential applications in drug development and organic synthesis. However, detailed studies would be necessary to fully understand its properties and potential uses.

Formula: C₁₃H₁₅NS

InChI: InChI=1S/C13H15NS/c1-10-3-4-13(11(2)7-10)14-8-12-5-6-15-9-12/h3-7,9,14H,8H2,1-2H3

InChI key: InChIKey=LLVYCQOLPRYCLI-UHFFFAOYSA-N

SMILES: N(CC=1C=CSC1)C2=C(C)C=C(C)C=C2

Synonyms:

• N-(2,4-Dimethylphenyl)-3-thiophenemethanamine
• 3-Thiophenemethanamine, N-(2,4-dimethylphenyl)-