
CAS 10195-79-6
:Hydrazinecarboxylic acid, compd. with hydrazine (1:1)
Description:
Hydrazinecarboxylic acid, compd. with hydrazine (1:1), identified by CAS number 10195-79-6, is a chemical compound that features a hydrazine moiety linked to a carboxylic acid. This compound typically exhibits characteristics associated with both hydrazine and carboxylic acids, including potential reactivity and the ability to form hydrogen bonds due to the presence of amine and carboxyl functional groups. It may appear as a colorless to light yellow liquid or solid, depending on its specific form and purity. The compound is likely to be hygroscopic, absorbing moisture from the air, and may be sensitive to heat and light, which can affect its stability. Hydrazine derivatives are known for their applications in various fields, including pharmaceuticals, agriculture, and as reducing agents in chemical synthesis. However, due to the toxicity and potential hazards associated with hydrazine and its derivatives, appropriate safety measures should be taken when handling this compound.
Formula:CH4N2O2·H4N2
InChI:InChI=1S/CH4N2O2.H4N2/c2-3-1(4)5;1-2/h3H,2H2,(H,4,5);1-2H2
InChI key:InChIKey=BPLLFUVTGWVFBI-UHFFFAOYSA-N
SMILES:C(NN)(=O)O.NN
Synonyms:- Hydrazinecarboxylic acid, compd. with hydrazine (1:1)
- Carbazic acid, hydrazine salt
- Carbazic acid, compd. with hydrazine (1:1)
- Hydrazine, monohydrazinecarboxylate
- Hydrazine, monocarbazate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
