
CAS 1019537-57-5
:N1,N1,2,2-Tetramethyl-N3-(1-methylbutyl)-1,3-propanediamine
Description:
N1,N1,2,2-Tetramethyl-N3-(1-methylbutyl)-1,3-propanediamine, with CAS number 1019537-57-5, is an organic compound characterized by its complex structure featuring multiple alkyl groups. It belongs to the class of diamines, which are compounds containing two amine functional groups. This particular substance has a branched alkyl chain, contributing to its hydrophobic properties, while the presence of the amine groups imparts basicity and potential reactivity in various chemical reactions. The tetramethyl groups enhance steric hindrance, which can influence its interaction with other molecules. The compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its applications may include use as a building block in organic synthesis, particularly in the production of polymers or as a ligand in coordination chemistry. Safety data should be consulted for handling and storage, as amines can be irritants and may pose health risks.
Formula:C12H28N2
InChI:InChI=1S/C12H28N2/c1-7-8-11(2)13-9-12(3,4)10-14(5)6/h11,13H,7-10H2,1-6H3
InChI key:InChIKey=DVSNGTXMEDYWGE-UHFFFAOYSA-N
SMILES:C(C(CN(C)C)(C)C)NC(CCC)C
Synonyms:- 1,3-Propanediamine, N1,N1,2,2-tetramethyl-N3-(1-methylbutyl)-
- N1,N1,2,2-Tetramethyl-N3-(1-methylbutyl)-1,3-propanediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.