CAS 1019539-10-6

2-[(1,1-Dimethylethyl)thio]-4-pyridinecarboxylic acid

Description:

2-[(1,1-Dimethylethyl)thio]-4-pyridinecarboxylic acid is an organic compound characterized by the presence of a pyridine ring substituted with a carboxylic acid group and a thioether group. The thioether moiety, derived from 1,1-dimethylethyl, contributes to the compound's unique properties, including potential steric hindrance and lipophilicity. This compound typically exhibits moderate solubility in organic solvents and limited solubility in water, which is common for many pyridine derivatives. Its structure suggests potential applications in pharmaceuticals and agrochemicals, particularly due to the presence of the carboxylic acid functional group, which can participate in various chemical reactions, including esterification and amidation. Additionally, the thioether group may enhance the compound's reactivity and interaction with biological targets. Overall, 2-[(1,1-Dimethylethyl)thio]-4-pyridinecarboxylic acid is a versatile compound with interesting chemical behavior and potential utility in various fields of research and industry.

Formula: C₁₀H₁₃NO₂S

InChI: InChI=1S/C10H13NO2S/c1-10(2,3)14-8-6-7(9(12)13)4-5-11-8/h4-6H,1-3H3,(H,12,13)

InChI key: InChIKey=ZFEKRVIJJMIJBO-UHFFFAOYSA-N

SMILES: S(C(C)(C)C)C1=CC(C(O)=O)=CC=N1

Synonyms:

• 2-[(1,1-Dimethylethyl)thio]-4-pyridinecarboxylic acid
• 4-Pyridinecarboxylic acid, 2-[(1,1-dimethylethyl)thio]-

2-(tert-Butylsulfanyl)pyridine-4-carboxylic acid

CAS: 1019539-10-6

Versatile small molecule scaffold

Formula: C₁₀H₁₃NO₂S

Purity: Min. 95%

Molecular weight: 211.28 g/mol

Ref: 3D-UQB53910