CAS 1019554-61-0

2-[[(2,3-Dihydro-1H-inden-5-yl)amino]methyl]-6-ethoxyphenol

Description:

2-[[(2,3-Dihydro-1H-inden-5-yl)amino]methyl]-6-ethoxyphenol, identified by its CAS number 1019554-61-0, is a chemical compound characterized by its complex structure, which includes an indene moiety and an ethoxy-substituted phenol. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the amino group suggests potential for hydrogen bonding and interactions with other polar molecules, while the ethoxy group may enhance lipophilicity, influencing its behavior in biological systems. The compound's structure indicates it may possess biological activity, possibly serving as a pharmacophore in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for confirmation of structure. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact. Further research would be necessary to fully elucidate its properties and applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₈H₂₁NO₂

InChI: InChI=1S/C18H21NO2/c1-2-21-17-8-4-7-15(18(17)20)12-19-16-10-9-13-5-3-6-14(13)11-16/h4,7-11,19-20H,2-3,5-6,12H2,1H3

InChI key: InChIKey=UPBJCAKXYMMSQY-UHFFFAOYSA-N

SMILES: N(CC1=C(O)C(OCC)=CC=C1)C=2C=C3C(=CC2)CCC3

Synonyms:

• 2-[[(2,3-Dihydro-1H-inden-5-yl)amino]methyl]-6-ethoxyphenol
• Phenol, 2-[[(2,3-dihydro-1H-inden-5-yl)amino]methyl]-6-ethoxy-