CymitQuimica logo

CAS 1019566-02-9

:

2-[[(2,4-Dimethylphenyl)amino]methyl]-6-ethoxyphenol

Description:
2-[[(2,4-Dimethylphenyl)amino]methyl]-6-ethoxyphenol, identified by its CAS number 1019566-02-9, is an organic compound characterized by its complex structure that includes an ethoxy group, a phenol moiety, and a dimethylphenyl amine. This compound typically exhibits properties associated with phenolic compounds, such as potential antioxidant activity and the ability to participate in hydrogen bonding due to the hydroxyl group. The presence of the dimethylphenyl group may influence its solubility and reactivity, making it more lipophilic. Additionally, the ethoxy group can enhance its stability and alter its interaction with biological systems. Such compounds are often studied for their applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific characteristics, including melting point, boiling point, and spectral properties, would depend on the compound's purity and the conditions under which it is analyzed. Overall, this compound's unique structure suggests potential utility in various chemical and biological applications.
Formula:C17H21NO2
InChI:InChI=1S/C17H21NO2/c1-4-20-16-7-5-6-14(17(16)19)11-18-15-9-8-12(2)10-13(15)3/h5-10,18-19H,4,11H2,1-3H3
InChI key:InChIKey=HUCIWMYNACRHTA-UHFFFAOYSA-N
SMILES:C(NC1=C(C)C=C(C)C=C1)C2=C(O)C(OCC)=CC=C2
Synonyms:
  • 2-[[(2,4-Dimethylphenyl)amino]methyl]-6-ethoxyphenol
  • Phenol, 2-[[(2,4-dimethylphenyl)amino]methyl]-6-ethoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.