
CAS 101959-38-0
:n-Octacosyl 4-hydroxy-trans-cinnamate
Description:
n-Octacosyl 4-hydroxy-trans-cinnamate, with the CAS number 101959-38-0, is an organic compound that belongs to the class of esters. It is characterized by its long hydrocarbon chain, which contributes to its hydrophobic properties, making it soluble in organic solvents but less so in water. The compound features a cinnamate moiety, which is derived from cinnamic acid, and includes a hydroxyl group that imparts some polar characteristics. This structure allows it to exhibit potential antioxidant and UV-absorbing properties, making it of interest in cosmetic and pharmaceutical applications. Additionally, its long alkyl chain enhances its ability to function as an emulsifier or surfactant in formulations. The compound is typically stable under normal conditions but may undergo degradation when exposed to extreme pH or light. Overall, n-Octacosyl 4-hydroxy-trans-cinnamate is valued for its functional properties in various industrial applications, particularly in the formulation of skin care products.
Formula:C37H64O3
InChI:InChI=1S/C37H64O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-34-40-37(39)33-30-35-28-31-36(38)32-29-35/h28-33,38H,2-27,34H2,1H3/b33-30+
InChI key:InChIKey=CWHBUKZWMZSTEA-KKYHWDRJSA-N
SMILES:C(=C/C(OCCCCCCCCCCCCCCCCCCCCCCCCCCCC)=O)\C1=CC=C(O)C=C1
Synonyms:- n-Octacosyl 4-hydroxy-trans-cinnamate
- 2-Propenoic acid, 3-(4-hydroxyphenyl)-, octacosyl ester, (2E)-
- n-Octacosyl trans-p-coumarate
- 2-Propenoic acid, 3-(4-hydroxyphenyl)-, octacosyl ester, (E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Propenoic acid, 3-(4-hydroxyphenyl)-, octacosyl ester, (2E)-
CAS:Formula:C37H64O3Molecular weight:556.9023
