CymitQuimica logo

CAS 10196-39-1

:

3,3-Diethyloxetane

Description:
3,3-Diethyloxetane is a cyclic ether characterized by its four-membered ring structure, which includes two ethyl groups attached to the third carbon atom of the oxetane ring. This compound is known for its relatively low boiling point and moderate stability, typical of small cyclic ethers. Its molecular formula reflects the presence of carbon, hydrogen, and oxygen, contributing to its chemical properties. 3,3-Diethyloxetane is generally colorless and may have a faint odor. It is soluble in organic solvents, making it useful in various chemical applications, including as a potential intermediate in organic synthesis. The presence of the ethyl groups can influence its reactivity, making it more sterically hindered compared to simpler oxetanes. Additionally, due to its cyclic structure, it may exhibit unique properties such as ring strain, which can affect its reactivity and stability under certain conditions. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H14O
InChI:InChI=1S/C7H14O/c1-3-7(4-2)5-8-6-7/h3-6H2,1-2H3
InChI key:InChIKey=VFYHHERJNPKXIX-UHFFFAOYSA-N
SMILES:C(C)C1(CC)COC1
Synonyms:
  • 3,3-Diethyloxetane
  • Oxetane, 3,3-diethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.