CAS 10196-69-7
:Strontium stearate
Description:
Strontium stearate is an organic compound with the chemical formula C36H70O4Sr. It is a salt formed from strontium and stearic acid, a long-chain fatty acid. This compound typically appears as a white to off-white powder and is insoluble in water but soluble in organic solvents such as benzene and chloroform. Strontium stearate is primarily used as a lubricant and stabilizer in various applications, including plastics and rubber manufacturing. It can also serve as a release agent in the production of molded products. In terms of thermal stability, strontium stearate can withstand moderate temperatures, making it suitable for applications that involve heat processing. Additionally, it exhibits properties typical of metal stearates, such as acting as a surfactant and providing anti-caking characteristics. Safety data indicates that while it is generally considered low in toxicity, appropriate handling and safety measures should be observed to minimize exposure.
Formula:C18H36O2Sr
InChI:InChI=1S/C18H36O2.Sr/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2-17H2,1H3,(H,19,20);
InChI key:InChIKey=RIBCJYJORLBDDA-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCC)CCCCCC(O)=O.[Sr]
Synonyms:- Strontium stearate
- Stearic acid, strontium salt
- Strontium distearate
- Octadecanoic acid, strontium salt (2:1)
- Octadecanoic acid, strontium salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
