
CAS 101961-60-8
:2-[2-(2-Methylpropyl)-2-oxidodiazenyl]-2-propenoic acid
Description:
2-[2-(2-Methylpropyl)-2-oxidodiazenyl]-2-propenoic acid, also known by its CAS number 101961-60-8, is a chemical compound characterized by its azo functional group, which is indicative of its potential use in dye applications. This compound features a propenoic acid backbone, suggesting it possesses both unsaturation and acidic properties. The presence of the 2-methylpropyl group contributes to its hydrophobic characteristics, which may influence its solubility and reactivity in various environments. The azo group (–N=N–) is known for its stability and ability to form colored compounds, making it relevant in the field of organic dyes and pigments. Additionally, the compound's structure suggests potential applications in polymer chemistry, particularly in the synthesis of functionalized polymers or as a reactive monomer. Overall, the unique combination of functional groups in this compound may lead to diverse applications in materials science, organic synthesis, and potentially in biological systems, although specific reactivity and stability would depend on environmental conditions.
Formula:C7H12N2O3
InChI:InChI=1S/C7H12N2O3/c1-5(2)4-9(12)8-6(3)7(10)11/h5H,3-4H2,1-2H3,(H,10,11)
InChI key:InChIKey=DTXMRELKPKEPSO-UHFFFAOYSA-N
SMILES:N(=NC(C(O)=O)=C)(CC(C)C)=O
Synonyms:- 2-Propenoic acid, 2-[(2-methylpropyl)-ONN-azoxy]-
- (1-Carboxyeth-1-en-1-yl)[(2-methylpropyl)-oxo-λ5-azanylidene]amine
- Valanimycin
- 2-[2-(2-Methylpropyl)-2-oxidodiazenyl]-2-propenoic acid
- 2-Propenoic acid, 2-[2-(2-methylpropyl)-2-oxidodiazenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Valanimycin
CAS:Valanimycin is a biochemical.Formula:C7H12N2O3Color and Shape:SolidMolecular weight:172.18
