CAS 1019625-49-0

3-Piperidinecarboxamide, 1-[4-(aminomethyl)phenyl]-

Description:

3-Piperidinecarboxamide, 1-[4-(aminomethyl)phenyl]- is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a carboxamide functional group, indicating the presence of a carbonyl group (C=O) directly bonded to a nitrogen atom (N). The presence of a 4-(aminomethyl)phenyl substituent suggests that there is a phenyl ring with an amino group attached to a methylene (-CH2-) bridge, enhancing its potential for hydrogen bonding and interactions with biological targets. This compound may exhibit properties typical of amides, such as moderate solubility in polar solvents and potential biological activity, making it of interest in medicinal chemistry. Its specific applications and interactions would depend on its structural characteristics and the presence of functional groups, which could influence its pharmacological properties. As with many compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₃H₁₉N₃O

InChI: InChI=1S/C13H19N3O/c14-8-10-3-5-12(6-4-10)16-7-1-2-11(9-16)13(15)17/h3-6,11H,1-2,7-9,14H2,(H2,15,17)

InChI key: InChIKey=YTLTVQZZOODNAT-UHFFFAOYSA-N

SMILES: C(N)(=O)C1CN(CCC1)C2=CC=C(CN)C=C2

Synonyms:

• 1-[4-(Aminomethyl)phenyl]piperidine-3-carboxamide
• 3-Piperidinecarboxamide, 1-[4-(aminomethyl)phenyl]-

1-[4-(Aminomethyl)phenyl]piperidine-3-carboxamide

CAS: 1019625-49-0

Versatile small molecule scaffold

Formula: C₁₃H₁₉N₃O

Purity: Min. 95%

Molecular weight: 233.31 g/mol

Ref: 3D-UQB62549