CymitQuimica logo

CAS 1019625-50-3

:

N3-Cyclohexyl-N1,N1-diethyl-1,3-propanediamine

Description:
N3-Cyclohexyl-N1,N1-diethyl-1,3-propanediamine, identified by its CAS number 1019625-50-3, is an organic compound characterized by its structure, which includes a cyclohexyl group and two ethyl substituents attached to a propanediamine backbone. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the cyclohexyl group may impart hydrophobic characteristics, while the ethyl groups can enhance its steric bulk. As a diamine, it has two amine functional groups, which can participate in various chemical reactions, including those involving nucleophilic substitution or coordination with metal ions. Its potential applications may span across fields such as pharmaceuticals, agrochemicals, or materials science, depending on its reactivity and interaction with other chemical species. Safety and handling precautions should be observed, as with many amines, due to potential irritant properties.
Formula:C13H28N2
InChI:InChI=1S/C13H28N2/c1-3-15(4-2)12-8-11-14-13-9-6-5-7-10-13/h13-14H,3-12H2,1-2H3
InChI key:InChIKey=HWBLMLAOGLPCEK-UHFFFAOYSA-N
SMILES:N(CCCN(CC)CC)C1CCCCC1
Synonyms:
  • N3-Cyclohexyl-N1,N1-diethyl-1,3-propanediamine
  • 1,3-Propanediamine, N3-cyclohexyl-N1,N1-diethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.