CAS 101975-15-9
:4'-(1,1,2,2-Tetrafluoroethoxy)acetophenone
Description:
4'-(1,1,2,2-Tetrafluoroethoxy)acetophenone, with the CAS number 101975-15-9, is an organic compound characterized by its acetophenone backbone substituted with a tetrafluoroethoxy group. This compound typically exhibits a molecular structure that includes a phenyl ring attached to a carbonyl group (ketone) and an ether functional group featuring four fluorine atoms. The presence of the tetrafluoroethoxy moiety imparts unique properties, such as increased hydrophobicity and potential thermal stability, which can influence its reactivity and solubility in various solvents. The fluorinated group may also enhance the compound's resistance to chemical degradation. In terms of applications, compounds like this are often explored in materials science, pharmaceuticals, and agrochemicals due to their distinctive chemical properties. Safety data sheets should be consulted for handling and storage guidelines, as fluorinated compounds can pose specific health and environmental risks. Overall, 4'-(1,1,2,2-Tetrafluoroethoxy)acetophenone represents a specialized class of fluorinated organic compounds with potential utility in various chemical applications.
Formula:C10H8F4O2
InChI:InChI=1/C10H8F4O2/c1-6(15)7-2-4-8(5-3-7)16-10(13,14)9(11)12/h2-5,9H,1H3
SMILES:CC(=O)c1ccc(cc1)OC(C(F)F)(F)F
Synonyms:- 1-[4-(1,1,2,2-Tetrafluoroethoxy)Phenyl]Ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-[4-(1,1,2,2-Tetrafluoroethoxy)phenyl]ethanone
CAS:1-[4-(1,1,2,2-Tetrafluoroethoxy)phenyl]ethanone
Molecular weight:236.16293g/mol


