CAS 101975-16-0
:1-[3-(1,1,2,2-Tetrafluoroethoxy)phenyl]ethanone
Description:
1-[3-(1,1,2,2-Tetrafluoroethoxy)phenyl]ethanone, with the CAS number 101975-16-0, is an organic compound characterized by its unique structure that includes a phenyl group substituted with a tetrafluoroethoxy moiety and an ethanone functional group. This compound is likely to exhibit properties typical of aromatic ketones, such as a relatively high boiling point and moderate solubility in organic solvents. The presence of the tetrafluoroethoxy group introduces significant electronegativity and hydrophobic characteristics, which can influence its reactivity and interactions with other substances. Additionally, the fluorinated ethoxy group may impart unique thermal and chemical stability, making it useful in various applications, including pharmaceuticals and materials science. The compound's reactivity may be affected by the electron-withdrawing nature of the fluorine atoms, which can stabilize certain intermediates in chemical reactions. Overall, this compound's distinct structural features contribute to its potential utility in specialized chemical applications.
Formula:C10H8F4O2
InChI:InChI=1/C10H8F4O2/c1-6(15)7-3-2-4-8(5-7)16-10(13,14)9(11)12/h2-5,9H,1H3
InChI key:InChIKey=KUBYFKIIUDRJFT-UHFFFAOYSA-N
SMILES:O(C(C(F)F)(F)F)C1=CC(C(C)=O)=CC=C1
Synonyms:- 3-(1,1,2,2-Tetrafluoroethoxy)acetophenone
- ethanone, 1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-
- 1-[3-(1,1,2,2-Tetrafluoroethoxy)phenyl]ethanone
- Ethanone, 1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-[3-(1,1,2,2-Tetrafluoroethoxy)phenyl]ethanone
CAS:<p>1-[3-(1,1,2,2-Tetrafluoroethoxy)phenyl]ethanone</p>Molecular weight:236.16293g/mol

