CAS 101976-91-4

[(1S,2R)-2-hydroxycyclohexyl]acetonitrile

Description:

[(1S,2R)-2-hydroxycyclohexyl]acetonitrile, with the CAS number 101976-91-4, is an organic compound characterized by its unique structural features. It contains a cyclohexane ring with a hydroxyl group (-OH) at the 2-position and an acetonitrile group (-C≡N) attached to the carbon adjacent to the hydroxyl. This compound exhibits chirality due to the presence of stereocenters, specifically at the 1 and 2 positions of the cyclohexane ring, leading to distinct enantiomers. The hydroxyl group contributes to its potential solubility in polar solvents, while the acetonitrile moiety introduces a polar functional group that can participate in various chemical reactions, including nucleophilic substitutions. The compound may be of interest in synthetic organic chemistry and pharmaceutical applications due to its functional groups, which can facilitate further chemical transformations. Additionally, its stereochemistry may influence its biological activity and interactions with other molecules. Overall, [(1S,2R)-2-hydroxycyclohexyl]acetonitrile is a versatile compound with potential applications in various fields.

Formula: C₈H₁₃NO

InChI: InChI=1/C8H13NO/c9-6-5-7-3-1-2-4-8(7)10/h7-8,10H,1-5H2/t7-,8+/m0/s1