CymitQuimica logo

CAS 10198-89-7

:

Dipyridylpropanedione; 98%

Description:
Dipyridylpropanedione, also known by its CAS number 10198-89-7, is an organic compound characterized by the presence of two pyridine rings and a diketone functional group. This compound typically appears as a crystalline solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. It is often used in coordination chemistry as a ligand due to its ability to form stable complexes with various metal ions. The presence of the diketone moiety allows for potential reactivity in various chemical transformations, making it useful in synthetic organic chemistry. Additionally, its derivatives may exhibit interesting biological activities, which can be explored in pharmaceutical research. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested. Overall, dipyridylpropanedione is a versatile compound with applications in both academic research and industrial processes.
Formula:C13H10N2O2
InChI:InChI=1/C13H10N2O2/c16-12(10-5-1-3-7-14-10)9-13(17)11-6-2-4-8-15-11/h1-8H,9H2
InChI key:DCGUVLMWGIPVDP-UHFFFAOYSA-N
SMILES:c1ccnc(c1)C(=O)CC(=O)c1ccccn1
Synonyms:
  • 1,3-Di(2-pyridyl)-1,3-propanedione
  • 1,3-Dipyridin-2-Ylpropane-1,3-Dione
Found 6 products.