CAS 1019851-94-5

4-Piperidinecarboxamide, N-butyl-, hydrochloride (1:1)

Description:

4-Piperidinecarboxamide, N-butyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a butyl group attached to the nitrogen of the piperidine, enhancing its lipophilicity and potentially influencing its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. The presence of the carboxamide functional group contributes to its polar characteristics, affecting its interaction with biological systems. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific applications and effects would depend on further studies, including its mechanism of action and potential therapeutic uses. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings.

Formula: C₁₀H₂₀N₂O·ClH

InChI: InChI=1S/C10H20N2O.ClH/c1-2-3-6-12-10(13)9-4-7-11-8-5-9;/h9,11H,2-8H2,1H3,(H,12,13);1H

InChI key: InChIKey=OZYZISQOEYRPGI-UHFFFAOYSA-N

SMILES: C(NCCCC)(=O)C1CCNCC1.Cl

Synonyms:

• 4-Piperidinecarboxamide, N-butyl-, hydrochloride (1:1)
• N-Butyl-4-piperidinecarboxamide hydrochloride

N-butylpiperidine-4-carboxamide, HCl

CAS: 1019851-94-5

Formula: C₁₀H₂₁ClN₂O

Molecular weight: 220.7395

Ref: IN-DA01AB0V

N-Butyl-4-piperidinecarboxamide hydrochloride

CAS: 1019851-94-5

Versatile small molecule scaffold

Formula: C₁₀H₂₁ClN₂O

Purity: Min. 95%

Molecular weight: 220.74 g/mol

Ref: 3D-UQB85194