CAS 1019851-96-7

4-Piperidinecarboxamide, N-[2-(dimethylamino)ethyl]-, hydrochloride (1:2)

Description:

4-Piperidinecarboxamide, N-[2-(dimethylamino)ethyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a carboxamide functional group, contributing to its potential as a pharmacological agent. The presence of a dimethylaminoethyl side chain enhances its solubility and bioavailability, making it relevant in medicinal chemistry. As a hydrochloride salt, it is typically more stable and easier to handle than its free base form, often resulting in improved solubility in aqueous solutions. The compound may exhibit various biological activities, potentially acting on neurotransmitter systems, which is common for piperidine derivatives. Its specific applications and effects would depend on further pharmacological studies. Safety and handling precautions are essential, as with all chemical substances, particularly those with potential biological activity. Proper storage conditions and adherence to safety guidelines are crucial for laboratory work involving this compound.

Formula: C₁₀H₂₁N₃O·2ClH

InChI: InChI=1S/C10H21N3O.2ClH/c1-13(2)8-7-12-10(14)9-3-5-11-6-4-9;;/h9,11H,3-8H2,1-2H3,(H,12,14);2*1H

InChI key: InChIKey=SNRMOBCIOUJLTF-UHFFFAOYSA-N

SMILES: C(NCCN(C)C)(=O)C1CCNCC1.Cl

Synonyms:

• 4-Piperidinecarboxamide, N-[2-(dimethylamino)ethyl]-, hydrochloride (1:2)

N-[2-(dimethylamino)ethyl]piperidine-4-carboxamide dihydrochloride

CAS: 1019851-96-7

Formula: C₁₀H₂₃Cl₂N₃O

Purity: 95.0%

Color and Shape: Solid, White solid

Molecular weight: 272.21

Ref: 10-F351724

N-[2-(Dimethylamino)ethyl]piperidine-4-carboxamide dihydrochloride

CAS: 1019851-96-7

Versatile small molecule scaffold

Formula: C₁₀H₂₃Cl₂N₃O

Purity: Min. 95%

Molecular weight: 272.21 g/mol

Ref: 3D-UQB85196