CAS 1019851-97-8

4-Piperidinecarboxamide, N-(2-hydroxyethyl)-, hydrochloride (1:1)

Description:

4-Piperidinecarboxamide, N-(2-hydroxyethyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which contributes to its basic properties. This substance features a carboxamide functional group, enhancing its solubility in polar solvents, and a hydroxyethyl side chain that may influence its biological activity and interaction with other molecules. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form. The presence of the hydrochloride indicates that the compound can exist as a cation in solution, which may affect its pharmacokinetics and bioavailability. This compound is of interest in medicinal chemistry, potentially serving as a precursor or active ingredient in pharmaceutical formulations. Its specific applications and effects would depend on further studies, including its mechanism of action, toxicity profile, and therapeutic potential. As with any chemical substance, proper handling and safety measures should be observed due to its potential biological activity.

Formula: C₈H₁₆N₂O₂·ClH

InChI: InChI=1S/C8H16N2O2.ClH/c11-6-5-10-8(12)7-1-3-9-4-2-7;/h7,9,11H,1-6H2,(H,10,12);1H

InChI key: InChIKey=VWJRMSGHPFYBCQ-UHFFFAOYSA-N

SMILES: C(NCCO)(=O)C1CCNCC1.Cl

Synonyms:

• 4-Piperidinecarboxamide, N-(2-hydroxyethyl)-, hydrochloride (1:1)