CAS 1019852-04-0
:3-Piperidinecarboxamide, hydrochloride (1:1)
Description:
3-Piperidinecarboxamide, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a carboxamide functional group, contributing to its potential as a pharmacological agent. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its bioavailability for various applications. The presence of the hydrochloride indicates that the compound is in a protonated state, which can influence its interaction with biological systems. This substance may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for drug development, particularly in the fields of medicinal chemistry and pharmacology. Its molecular interactions, stability, and reactivity can be influenced by the pH of the environment, making it important to consider these factors in experimental and therapeutic contexts. Safety data and handling precautions should be adhered to, as with all chemical substances, to ensure proper usage and minimize risks.
Formula:C6H12N2O·ClH
InChI:InChI=1S/C6H12N2O.ClH/c7-6(9)5-2-1-3-8-4-5;/h5,8H,1-4H2,(H2,7,9);1H
InChI key:InChIKey=XGTXRLSQNMCHPG-UHFFFAOYSA-N
SMILES:C(N)(=O)C1CCCNC1.Cl
Synonyms:- 3-Piperidinecarboxamide, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
