CAS 1019855-83-4
:N-[(4-Aminophenyl)methyl]cyclopropanesulfonamide
Description:
N-[(4-Aminophenyl)methyl]cyclopropanesulfonamide is a chemical compound characterized by its unique structure, which includes a cyclopropane ring, a sulfonamide group, and an amino-substituted phenyl moiety. This compound typically exhibits properties associated with sulfonamides, such as potential antibacterial activity, due to the presence of the sulfonamide functional group. The cyclopropane ring contributes to its rigidity and may influence its reactivity and interaction with biological targets. The amino group on the phenyl ring can participate in hydrogen bonding, enhancing its solubility and interaction with various biological systems. Additionally, the compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be studied for its potential applications in drug development or as a biochemical probe. As with many sulfonamide derivatives, understanding its mechanism of action and biological activity would be crucial for evaluating its therapeutic potential.
Formula:C10H14N2O2S
InChI:InChI=1S/C10H14N2O2S/c11-9-3-1-8(2-4-9)7-12-15(13,14)10-5-6-10/h1-4,10,12H,5-7,11H2
InChI key:InChIKey=WBXHRSGGAPUJHT-UHFFFAOYSA-N
SMILES:S(NCC1=CC=C(N)C=C1)(=O)(=O)C2CC2
Synonyms:- Cyclopropanesulfonamide, N-[(4-aminophenyl)methyl]-
- N-[(4-Aminophenyl)methyl]cyclopropanesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
