
CAS 10199-66-3
:Phenyl-1H-pyrazol-1-ylmethanone
Description:
Phenyl-1H-pyrazol-1-ylmethanone, with the CAS number 10199-66-3, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a phenyl group attached to the pyrazole, contributing to its aromatic properties. The presence of the carbonyl group (ketone) at the methanone position enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and condensation reactions. Phenyl-1H-pyrazol-1-ylmethanone is often studied for its biological activities, including potential applications in pharmaceuticals and agrochemicals. Its solubility and stability can vary depending on the solvent and environmental conditions, which is important for its practical applications. Additionally, the compound's molecular structure allows for various substitutions, leading to a diverse range of derivatives with potentially different properties and activities. Overall, this compound is of interest in both synthetic organic chemistry and medicinal chemistry due to its unique structural features and potential applications.
Formula:C10H8N2O
InChI:InChI=1S/C10H8N2O/c13-10(12-8-4-7-11-12)9-5-2-1-3-6-9/h1-8H
InChI key:InChIKey=PQKSGWWAKCJGLT-UHFFFAOYSA-N
SMILES:C(=O)(N1C=CC=N1)C2=CC=CC=C2
Synonyms:- Methanone, phenyl-1H-pyrazol-1-yl-
- 1H-Pyrazole, 1-benzoyl-
- 1-Benzoylpyrazole
- Phenyl-1H-pyrazol-1-ylmethanone
- Pyrazole, 1-benzoyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
