CAS 10199-90-3
:4-Azido-7-nitro-2,1,3-benzoxadiazole
Description:
4-Azido-7-nitro-2,1,3-benzoxadiazole (CAS 10199-90-3) is a chemical compound characterized by its unique structure, which includes a benzoxadiazole core with azido and nitro functional groups. This compound typically appears as a yellow to orange solid and is known for its photochemical properties, making it useful in various applications, including fluorescence and as a potential precursor in organic synthesis. The presence of the azido group contributes to its reactivity, particularly in click chemistry and other coupling reactions. Additionally, the nitro group can influence the electronic properties of the molecule, enhancing its utility in materials science and photonics. Due to its potential applications, safety considerations are important, as azido compounds can be sensitive and may pose risks under certain conditions. Overall, 4-Azido-7-nitro-2,1,3-benzoxadiazole is a versatile compound with significant relevance in research and industrial applications.
Formula:C6H2N6O3
InChI:InChI=1S/C6H2N6O3/c7-11-8-3-1-2-4(12(13)14)6-5(3)9-15-10-6/h1-2H
InChI key:InChIKey=YPRIQOMTFNRORM-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=2C(C(N=[N+]=[N-])=CC1)=NON2
Synonyms:- 4-Azido-7-nitrobenzofurazan
- Benzofurazan, 4-azido-7-nitro-
- 2,1,3-Benzoxadiazole, 4-azido-7-nitro-
- 4-Azido-7-nitro-2,1,3-benzoxadiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
